C14H22N2 — CID 59886840
(3R)-1-(2,5-dimethylphenyl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 59886840) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (3R)-1-(2,5-dimethylphenyl)-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | (3R)-1-(2,5-dimethylphenyl)-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 59886840 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (3R)-1-(2,5-dimethylphenyl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | Cc1ccc(C)c(N2CC[C@@H](N(C)C)C2)c1 |
| InChI | InChI=1S/C14H22N2/c1-11-5-6-12(2)14(9-11)16-8-7-13(10-16)15(3)4/h5-6,9,13H,7-8,10H2,1-4H3/t13-/m1/s1 |
| InChIKey | MZBIIALWEQYREK-CYBMUJFWSA-N |
| XLogP | 2.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |