C18H22BrN3O2 — CID 99784050
5-bromo-N-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methylphenyl]furan-2-carboxamide (PubChem CID 99784050) has the molecular formula C18H22BrN3O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 5-bromo-N-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methylphenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 99784050 |
| Molecular Formula | C18H22BrN3O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 5-bromo-N-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(Br)o2)cc1N1CC[C@@H](N(C)C)C1 |
| InChI | InChI=1S/C18H22BrN3O2/c1-12-4-5-13(20-18(23)16-6-7-17(19)24-16)10-15(12)22-9-8-14(11-22)21(2)3/h4-7,10,14H,8-9,11H2,1-3H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | FBXPALJKTLIRFI-CQSZACIVSA-N |
| XLogP | 3.74 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |