C16H22N2 — CID 155709362
1-(2-ethynyl-4-methylphenyl)-N,N-dimethylpiperidin-4-amine (PubChem CID 155709362) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-(2-ethynyl-4-methylphenyl)-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-(2-ethynyl-4-methylphenyl)-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 155709362 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-(2-ethynyl-4-methylphenyl)-N,N-dimethylpiperidin-4-amine |
| SMILES | C#Cc1cc(C)ccc1N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C16H22N2/c1-5-14-12-13(2)6-7-16(14)18-10-8-15(9-11-18)17(3)4/h1,6-7,12,15H,8-11H2,2-4H3 |
| InChIKey | CQPVJZOXKALTAQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|