C16H11ClO2 — CID 129385877
(9S,10R)-1-chloro-9,10-dihydroanthracene-9,10-dicarbaldehyde (PubChem CID 129385877) has the molecular formula C16H11ClO2 and a molecular weight of 270.72 g/mol. Its IUPAC name is (9S,10R)-1-chloro-9,10-dihydroanthracene-9,10-dicarbaldehyde.
| Compound Name | (9S,10R)-1-chloro-9,10-dihydroanthracene-9,10-dicarbaldehyde |
|---|---|
| PubChem CID | 129385877 |
| Molecular Formula | C16H11ClO2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | (9S,10R)-1-chloro-9,10-dihydroanthracene-9,10-dicarbaldehyde |
| SMILES | O=C[C@@H]1c2ccccc2[C@H](C=O)c2c(Cl)cccc21 |
| InChI | InChI=1S/C16H11ClO2/c17-15-7-3-6-12-13(8-18)10-4-1-2-5-11(10)14(9-19)16(12)15/h1-9,13-14H/t13-,14+/m1/s1 |
| InChIKey | SQRXDDXPBMBWJJ-KGLIPLIRSA-N |
| XLogP | 3.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|