C20H20N6O — CID 129386052
(3S,4S)-4-[4-[4-(1H-indazol-3-yl)triazol-1-yl]phenyl]piperidin-3-ol (PubChem CID 129386052) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is (3S,4S)-4-[4-[4-(1H-indazol-3-yl)triazol-1-yl]phenyl]piperidin-3-ol.
| Compound Name | (3S,4S)-4-[4-[4-(1H-indazol-3-yl)triazol-1-yl]phenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 129386052 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (3S,4S)-4-[4-[4-(1H-indazol-3-yl)triazol-1-yl]phenyl]piperidin-3-ol |
| SMILES | O[C@@H]1CNCC[C@H]1c1ccc(-n2cc(-c3n[nH]c4ccccc34)nn2)cc1 |
| InChI | InChI=1S/C20H20N6O/c27-19-11-21-10-9-15(19)13-5-7-14(8-6-13)26-12-18(23-25-26)20-16-3-1-2-4-17(16)22-24-20/h1-8,12,15,19,21,27H,9-11H2,(H,22,24)/t15-,19+/m0/s1 |
| InChIKey | CSPOTVLAMCAZQQ-HNAYVOBHSA-N |
| XLogP | 2.25 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |