C15H19F2NO — CID 129387347
4-[4-[[(1S)-2,2-difluorocyclopropyl]methoxy]phenyl]piperidine (PubChem CID 129387347) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-[4-[[(1S)-2,2-difluorocyclopropyl]methoxy]phenyl]piperidine.
| Compound Name | 4-[4-[[(1S)-2,2-difluorocyclopropyl]methoxy]phenyl]piperidine |
|---|---|
| PubChem CID | 129387347 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-[4-[[(1S)-2,2-difluorocyclopropyl]methoxy]phenyl]piperidine |
| SMILES | FC1(F)C[C@H]1COc1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C15H19F2NO/c16-15(17)9-13(15)10-19-14-3-1-11(2-4-14)12-5-7-18-8-6-12/h1-4,12-13,18H,5-10H2/t13-/m0/s1 |
| InChIKey | JDRUYYYPOSUKFE-ZDUSSCGKSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |