C13H15NO2 — CID 129387672
cis-(2S,4S)-2-acetyl-4-pyridin-3-ylcyclohexan-1-one (PubChem CID 129387672) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is cis-(2S,4S)-2-acetyl-4-pyridin-3-ylcyclohexan-1-one.
| Compound Name | cis-(2S,4S)-2-acetyl-4-pyridin-3-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 129387672 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | cis-(2S,4S)-2-acetyl-4-pyridin-3-ylcyclohexan-1-one |
| SMILES | CC(=O)[C@@H]1C[C@@H](c2cccnc2)CCC1=O |
| InChI | InChI=1S/C13H15NO2/c1-9(15)12-7-10(4-5-13(12)16)11-3-2-6-14-8-11/h2-3,6,8,10,12H,4-5,7H2,1H3/t10-,12-/m0/s1 |
| InChIKey | YHMBTWNQVFIUHF-JQWIXIFHSA-N |
| XLogP | 2.12 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|