C15H22N2O — CID 129388327
(4S,4aS,8aR)-4-(pyridin-3-ylamino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol (PubChem CID 129388327) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (4S,4aS,8aR)-4-(pyridin-3-ylamino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol.
| Compound Name | (4S,4aS,8aR)-4-(pyridin-3-ylamino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 129388327 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (4S,4aS,8aR)-4-(pyridin-3-ylamino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol |
| SMILES | O[C@@]12CCCC[C@@H]1CCC[C@@H]2Nc1cccnc1 |
| InChI | InChI=1S/C15H22N2O/c18-15-9-2-1-5-12(15)6-3-8-14(15)17-13-7-4-10-16-11-13/h4,7,10-12,14,17-18H,1-3,5-6,8-9H2/t12-,14+,15+/m1/s1 |
| InChIKey | NSUFSRJYAQOZOR-SNPRPXQTSA-N |
| XLogP | 2.97 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |