C16H21F2NO — CID 52911661
(4aR,8aR)-4-(2,3-difluoroanilino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol (PubChem CID 52911661) has the molecular formula C16H21F2NO and a molecular weight of 281.35 g/mol. Its IUPAC name is (4aR,8aR)-4-(2,3-difluoroanilino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol.
| Compound Name | (4aR,8aR)-4-(2,3-difluoroanilino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 52911661 |
| Molecular Formula | C16H21F2NO |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (4aR,8aR)-4-(2,3-difluoroanilino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol |
| SMILES | O[C@]12CCCC[C@@H]1CCCC2Nc1cccc(F)c1F |
| InChI | InChI=1S/C16H21F2NO/c17-12-7-4-8-13(15(12)18)19-14-9-3-6-11-5-1-2-10-16(11,14)20/h4,7-8,11,14,19-20H,1-3,5-6,9-10H2/t11-,14?,16-/m1/s1 |
| InChIKey | AIPLISPOZKCVAM-YTXUZFAGSA-N |
| XLogP | 3.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |