C15H13F2NS — CID 61075905
N-(2,3-difluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 61075905) has the molecular formula C15H13F2NS and a molecular weight of 277.34 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-(2,3-difluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 61075905 |
| Molecular Formula | C15H13F2NS |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(2,3-difluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | Fc1cccc(NC2CCSc3ccccc32)c1F |
| InChI | InChI=1S/C15H13F2NS/c16-11-5-3-6-13(15(11)17)18-12-8-9-19-14-7-2-1-4-10(12)14/h1-7,12,18H,8-9H2 |
| InChIKey | GYJNOXBMELSCQS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |