3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid

C16H14FNO2S — CID 43728124

IUPAC3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid
SMILESO=C(O)c1ccc(F)c(NC2CCSc3ccccc32)c1
InChIInChI=1S/C16H14FNO2S/c17-12-6-5-10(16(19)20)9-14(12)18-13-7-8-21-15-4-2-1-3-11(13)15/h1-6,9,13,18H,7-8H2,(H,19,20)
InChIKeyHTGTVECLNCWWSF-UHFFFAOYSA-N
MW303.36 g/mol
LogP4.17
Rot. Bonds3

About 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid

3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid (PubChem CID 43728124) has the molecular formula C16H14FNO2S and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid.

Molecular Properties

Compound Name3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid
PubChem CID43728124
Molecular FormulaC16H14FNO2S
Molecular Weight303.36 g/mol
Exact Mass303.07
IUPAC Name3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid
SMILESO=C(O)c1ccc(F)c(NC2CCSc3ccccc32)c1
InChIInChI=1S/C16H14FNO2S/c17-12-6-5-10(16(19)20)9-14(12)18-13-7-8-21-15-4-2-1-3-11(13)15/h1-6,9,13,18H,7-8H2,(H,19,20)
InChIKeyHTGTVECLNCWWSF-UHFFFAOYSA-N
XLogP4.17
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.36
LogP ≤ 54.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid?
The IUPAC name of 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid (CID 43728124) is 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid.
What is the SMILES notation for 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid?
The canonical SMILES for 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid is O=C(O)c1ccc(F)c(NC2CCSc3ccccc32)c1.
What is the InChIKey of 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid?
The InChIKey is HTGTVECLNCWWSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO2S/c17-12-6-5-10(16(19)20)9-14(12)18-13-7-8-21-15-4-2-1-3-11(13)15/h1-6,9,13,18H,7-8H2,(H,19,20).
What are the key properties of 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid?
3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid has a molecular weight of 303.36 g/mol, XLogP of 4.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid is sourced from PubChem (CID 43728124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).