C16H14FNO2S — CID 43728124
3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid (PubChem CID 43728124) has the molecular formula C16H14FNO2S and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid.
| Compound Name | 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 43728124 |
| Molecular Formula | C16H14FNO2S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-(3,4-dihydro-2H-thiochromen-4-ylamino)-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(NC2CCSc3ccccc32)c1 |
| InChI | InChI=1S/C16H14FNO2S/c17-12-6-5-10(16(19)20)9-14(12)18-13-7-8-21-15-4-2-1-3-11(13)15/h1-6,9,13,18H,7-8H2,(H,19,20) |
| InChIKey | HTGTVECLNCWWSF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |