C15H12F3NS — CID 62815698
N-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 62815698) has the molecular formula C15H12F3NS and a molecular weight of 295.33 g/mol. Its IUPAC name is N-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 62815698 |
| Molecular Formula | C15H12F3NS |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | Fc1cc(F)c(NC2CCSc3ccccc32)cc1F |
| InChI | InChI=1S/C15H12F3NS/c16-10-7-12(18)14(8-11(10)17)19-13-5-6-20-15-4-2-1-3-9(13)15/h1-4,7-8,13,19H,5-6H2 |
| InChIKey | FQPUMRKMNXUOGE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|