C14H9F4NS — CID 107644128
N-(2,3,5,6-tetrafluorophenyl)-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 107644128) has the molecular formula C14H9F4NS and a molecular weight of 299.29 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluorophenyl)-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | N-(2,3,5,6-tetrafluorophenyl)-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 107644128 |
| Molecular Formula | C14H9F4NS |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-(2,3,5,6-tetrafluorophenyl)-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | Fc1cc(F)c(F)c(NC2CSc3ccccc32)c1F |
| InChI | InChI=1S/C14H9F4NS/c15-8-5-9(16)13(18)14(12(8)17)19-10-6-20-11-4-2-1-3-7(10)11/h1-5,10,19H,6H2 |
| InChIKey | FGRAIAYPAGZGPC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|