C14H11Br2NS — CID 107597735
N-(2,6-dibromophenyl)-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 107597735) has the molecular formula C14H11Br2NS and a molecular weight of 385.12 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | N-(2,6-dibromophenyl)-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 107597735 |
| Molecular Formula | C14H11Br2NS |
| Molecular Weight | 385.12 g/mol |
| Exact Mass | 382.90 |
| IUPAC Name | N-(2,6-dibromophenyl)-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | Brc1cccc(Br)c1NC1CSc2ccccc21 |
| InChI | InChI=1S/C14H11Br2NS/c15-10-5-3-6-11(16)14(10)17-12-8-18-13-7-2-1-4-9(12)13/h1-7,12,17H,8H2 |
| InChIKey | LHEGQFWUKKRUIH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.12 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |