C10H13NS — CID 16639714
N,N-dimethyl-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 16639714) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is N,N-dimethyl-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | N,N-dimethyl-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 16639714 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | N,N-dimethyl-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | CN(C)C1CSc2ccccc21 |
| InChI | InChI=1S/C10H13NS/c1-11(2)9-7-12-10-6-4-3-5-8(9)10/h3-6,9H,7H2,1-2H3 |
| InChIKey | SCEATBIQEWQDQG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |