C14H10Cl2FNS — CID 107573009
N-(3,5-dichloro-4-fluorophenyl)-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 107573009) has the molecular formula C14H10Cl2FNS and a molecular weight of 314.21 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 107573009 |
| Molecular Formula | C14H10Cl2FNS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | Fc1c(Cl)cc(NC2CSc3ccccc32)cc1Cl |
| InChI | InChI=1S/C14H10Cl2FNS/c15-10-5-8(6-11(16)14(10)17)18-12-7-19-13-4-2-1-3-9(12)13/h1-6,12,18H,7H2 |
| InChIKey | ZDUPBRZDDYQOJY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|