C18H16N2S — CID 43192381
N-(3,4-dihydro-2H-thiochromen-4-yl)quinolin-5-amine (PubChem CID 43192381) has the molecular formula C18H16N2S and a molecular weight of 292.41 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-thiochromen-4-yl)quinolin-5-amine.
| Compound Name | N-(3,4-dihydro-2H-thiochromen-4-yl)quinolin-5-amine |
|---|---|
| PubChem CID | 43192381 |
| Molecular Formula | C18H16N2S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-(3,4-dihydro-2H-thiochromen-4-yl)quinolin-5-amine |
| SMILES | c1ccc2c(c1)SCCC2Nc1cccc2ncccc12 |
| InChI | InChI=1S/C18H16N2S/c1-2-9-18-14(5-1)17(10-12-21-18)20-16-8-3-7-15-13(16)6-4-11-19-15/h1-9,11,17,20H,10,12H2 |
| InChIKey | PEWFZXPMLBVCJR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |