C9H16O3 — CID 129389341
(4R)-3,9-dioxaspiro[5.5]undecan-4-ol (PubChem CID 129389341) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (4R)-3,9-dioxaspiro[5.5]undecan-4-ol.
| Compound Name | (4R)-3,9-dioxaspiro[5.5]undecan-4-ol |
|---|---|
| PubChem CID | 129389341 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (4R)-3,9-dioxaspiro[5.5]undecan-4-ol |
| SMILES | O[C@H]1CC2(CCOCC2)CCO1 |
| InChI | InChI=1S/C9H16O3/c10-8-7-9(3-6-12-8)1-4-11-5-2-9/h8,10H,1-7H2/t8-/m1/s1 |
| InChIKey | LEWONNGJAQPLKH-MRVPVSSYSA-N |
| XLogP | 0.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |