About 4,4-diiodooxane
4,4-diiodooxane (PubChem CID 138563806) has the molecular formula C5H8I2O
and a molecular weight of 337.93 g/mol. Its IUPAC name is 4,4-diiodooxane.
Molecular Properties
| Compound Name | 4,4-diiodooxane |
| PubChem CID | 138563806 |
| Molecular Formula | C5H8I2O |
| Molecular Weight | 337.93 g/mol |
| Exact Mass | 337.87 |
| IUPAC Name | 4,4-diiodooxane |
| SMILES | IC1(I)CCOCC1 |
| InChI | InChI=1S/C5H8I2O/c6-5(7)1-3-8-4-2-5/h1-4H2 |
| InChIKey | MUAWLCMXMFBCHJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.93 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diiodooxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diiodooxane?
The IUPAC name of 4,4-diiodooxane (CID 138563806) is 4,4-diiodooxane.
What is the SMILES notation for 4,4-diiodooxane?
The canonical SMILES for 4,4-diiodooxane is IC1(I)CCOCC1.
What is the InChIKey of 4,4-diiodooxane?
The InChIKey is MUAWLCMXMFBCHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8I2O/c6-5(7)1-3-8-4-2-5/h1-4H2.
What are the key properties of 4,4-diiodooxane?
4,4-diiodooxane has a molecular weight of 337.93 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diiodooxane is sourced from PubChem (CID 138563806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).