potassium 6-oxa-2-azanidaspiro[3.4]octane

C6H10KNO — CID 171656637

IUPACpotassium 6-oxa-2-azanidaspiro[3.4]octane
SMILESC1CC2(C[N-]C2)CO1.[K+]
InChIInChI=1S/C6H10NO.K/c1-2-8-5-6(1)3-7-4-6;/h1-5H2;/q-1;+1
InChIKeyHBWOPXIINIHFLC-UHFFFAOYSA-N
MW151.25 g/mol
LogP-2.22
Rot. Bonds

About potassium 6-oxa-2-azanidaspiro[3.4]octane

potassium 6-oxa-2-azanidaspiro[3.4]octane (PubChem CID 171656637) has the molecular formula C6H10KNO and a molecular weight of 151.25 g/mol. Its IUPAC name is potassium 6-oxa-2-azanidaspiro[3.4]octane.

Molecular Properties

Compound Namepotassium 6-oxa-2-azanidaspiro[3.4]octane
PubChem CID171656637
Molecular FormulaC6H10KNO
Molecular Weight151.25 g/mol
Exact Mass151.04
IUPAC Namepotassium 6-oxa-2-azanidaspiro[3.4]octane
SMILESC1CC2(C[N-]C2)CO1.[K+]
InChIInChI=1S/C6H10NO.K/c1-2-8-5-6(1)3-7-4-6;/h1-5H2;/q-1;+1
InChIKeyHBWOPXIINIHFLC-UHFFFAOYSA-N
XLogP-2.22
TPSA23.33 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.25
LogP ≤ 5-2.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze potassium 6-oxa-2-azanidaspiro[3.4]octane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 6-oxa-2-azanidaspiro[3.4]octane?
The IUPAC name of potassium 6-oxa-2-azanidaspiro[3.4]octane (CID 171656637) is potassium 6-oxa-2-azanidaspiro[3.4]octane.
What is the SMILES notation for potassium 6-oxa-2-azanidaspiro[3.4]octane?
The canonical SMILES for potassium 6-oxa-2-azanidaspiro[3.4]octane is C1CC2(C[N-]C2)CO1.[K+].
What is the InChIKey of potassium 6-oxa-2-azanidaspiro[3.4]octane?
The InChIKey is HBWOPXIINIHFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10NO.K/c1-2-8-5-6(1)3-7-4-6;/h1-5H2;/q-1;+1.
What are the key properties of potassium 6-oxa-2-azanidaspiro[3.4]octane?
potassium 6-oxa-2-azanidaspiro[3.4]octane has a molecular weight of 151.25 g/mol, XLogP of -2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 6-oxa-2-azanidaspiro[3.4]octane is sourced from PubChem (CID 171656637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).