C13H22O5 — CID 71344408
2,6,10,13,17-pentaoxadispiro[3.3.38.74]octadecane (PubChem CID 71344408) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 2,6,10,13,17-pentaoxadispiro[3.3.38.74]octadecane.
| Compound Name | 2,6,10,13,17-pentaoxadispiro[3.3.38.74]octadecane |
|---|---|
| PubChem CID | 71344408 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2,6,10,13,17-pentaoxadispiro[3.3.38.74]octadecane |
| SMILES | C1COCC2(COC2)COCC2(COC1)COC2 |
| InChI | InChI=1S/C13H22O5/c1-2-14-4-12(6-16-7-12)10-18-11-13(5-15-3-1)8-17-9-13/h1-11H2 |
| InChIKey | SUBKKBNMMSIULP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |