C11H20ClNO — CID 129389725
(4aR,8aR)-5-(3-chloropropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine (PubChem CID 129389725) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is (4aR,8aR)-5-(3-chloropropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine.
| Compound Name | (4aR,8aR)-5-(3-chloropropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine |
|---|---|
| PubChem CID | 129389725 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (4aR,8aR)-5-(3-chloropropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine |
| SMILES | ClCCCN1CCC[C@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C11H20ClNO/c12-6-3-8-13-7-1-5-11-10(13)4-2-9-14-11/h10-11H,1-9H2/t10-,11-/m1/s1 |
| InChIKey | LWTLIMXYTXOIBO-GHMZBOCLSA-N |
| XLogP | 2.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|