C13H24ClNO — CID 62227452
4-(6-chlorohexyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 62227452) has the molecular formula C13H24ClNO and a molecular weight of 245.79 g/mol. Its IUPAC name is 4-(6-chlorohexyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 4-(6-chlorohexyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 62227452 |
| Molecular Formula | C13H24ClNO |
| Molecular Weight | 245.79 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 4-(6-chlorohexyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | ClCCCCCCN1CCOC2CCCC21 |
| InChI | InChI=1S/C13H24ClNO/c14-8-3-1-2-4-9-15-10-11-16-13-7-5-6-12(13)15/h12-13H,1-11H2 |
| InChIKey | ZGCLSJUZTRYFGH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.79 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|