C16H34O5P2 — CID 129390512
[(1R)-1-[hydroxy(pent-4-enyl)phosphoryl]undecyl]phosphonic acid (PubChem CID 129390512) has the molecular formula C16H34O5P2 and a molecular weight of 368.39 g/mol. Its IUPAC name is [(1R)-1-[hydroxy(pent-4-enyl)phosphoryl]undecyl]phosphonic acid.
| Compound Name | [(1R)-1-[hydroxy(pent-4-enyl)phosphoryl]undecyl]phosphonic acid |
|---|---|
| PubChem CID | 129390512 |
| Molecular Formula | C16H34O5P2 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [(1R)-1-[hydroxy(pent-4-enyl)phosphoryl]undecyl]phosphonic acid |
| SMILES | C=CCCCP(=O)(O)[C@@H](CCCCCCCCCC)P(=O)(O)O |
| InChI | InChI=1S/C16H34O5P2/c1-3-5-7-8-9-10-11-12-14-16(23(19,20)21)22(17,18)15-13-6-4-2/h4,16H,2-3,5-15H2,1H3,(H,17,18)(H2,19,20,21)/t16-/m1/s1 |
| InChIKey | DVWUAIHOPXPRIR-MRXNPFEDSA-N |
| XLogP | 5.26 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|