C17H20BrNO3 — CID 129390967
(1S)-2-[(2-bromophenyl)methylamino]-1-(3,4-dimethoxyphenyl)ethanol (PubChem CID 129390967) has the molecular formula C17H20BrNO3 and a molecular weight of 366.26 g/mol. Its IUPAC name is (1S)-2-[(2-bromophenyl)methylamino]-1-(3,4-dimethoxyphenyl)ethanol.
| Compound Name | (1S)-2-[(2-bromophenyl)methylamino]-1-(3,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 129390967 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (1S)-2-[(2-bromophenyl)methylamino]-1-(3,4-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc([C@H](O)CNCc2ccccc2Br)cc1OC |
| InChI | InChI=1S/C17H20BrNO3/c1-21-16-8-7-12(9-17(16)22-2)15(20)11-19-10-13-5-3-4-6-14(13)18/h3-9,15,19-20H,10-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | YVUXRNIUGKNHAP-OAHLLOKOSA-N |
| XLogP | 3.29 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |