2-[(2S,4S)-2-aminooxan-4-yl]acetic acid

C7H13NO3 — CID 129391535

IUPAC2-[(2S,4S)-2-aminooxan-4-yl]acetic acid
SMILESN[C@@H]1C[C@@H](CC(=O)O)CCO1
InChIInChI=1S/C7H13NO3/c8-6-3-5(1-2-11-6)4-7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6-/m0/s1
InChIKeyCABYYWOZFJDGCS-WDSKDSINSA-N
MW159.18 g/mol
LogP0.17
Rot. Bonds2

About 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid

2-[(2S,4S)-2-aminooxan-4-yl]acetic acid (PubChem CID 129391535) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid.

Molecular Properties

Compound Name2-[(2S,4S)-2-aminooxan-4-yl]acetic acid
PubChem CID129391535
Molecular FormulaC7H13NO3
Molecular Weight159.18 g/mol
Exact Mass159.09
IUPAC Name2-[(2S,4S)-2-aminooxan-4-yl]acetic acid
SMILESN[C@@H]1C[C@@H](CC(=O)O)CCO1
InChIInChI=1S/C7H13NO3/c8-6-3-5(1-2-11-6)4-7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6-/m0/s1
InChIKeyCABYYWOZFJDGCS-WDSKDSINSA-N
XLogP0.17
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.18
LogP ≤ 50.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid?
The IUPAC name of 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid (CID 129391535) is 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid.
What is the SMILES notation for 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid?
The canonical SMILES for 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid is N[C@@H]1C[C@@H](CC(=O)O)CCO1.
What is the InChIKey of 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid?
The InChIKey is CABYYWOZFJDGCS-WDSKDSINSA-N. The full InChI is InChI=1S/C7H13NO3/c8-6-3-5(1-2-11-6)4-7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6-/m0/s1.
What are the key properties of 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid?
2-[(2S,4S)-2-aminooxan-4-yl]acetic acid has a molecular weight of 159.18 g/mol, XLogP of 0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,4S)-2-aminooxan-4-yl]acetic acid is sourced from PubChem (CID 129391535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).