C19H33NO2 — CID 134308641
2-[(3R)-3-[4-(4-aminocyclohexyl)cyclohexyl]cyclopentyl]acetic acid (PubChem CID 134308641) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 2-[(3R)-3-[4-(4-aminocyclohexyl)cyclohexyl]cyclopentyl]acetic acid.
| Compound Name | 2-[(3R)-3-[4-(4-aminocyclohexyl)cyclohexyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 134308641 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 2-[(3R)-3-[4-(4-aminocyclohexyl)cyclohexyl]cyclopentyl]acetic acid |
| SMILES | NC1CCC(C2CCC([C@@H]3CCC(CC(=O)O)C3)CC2)CC1 |
| InChI | InChI=1S/C19H33NO2/c20-18-9-7-15(8-10-18)14-3-5-16(6-4-14)17-2-1-13(11-17)12-19(21)22/h13-18H,1-12,20H2,(H,21,22)/t13?,14?,15?,16?,17-,18?/m1/s1 |
| InChIKey | XYOXFXOZYNZQPT-SVXFNXITSA-N |
| XLogP | 4.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |