C17H17ClN2O2 — CID 129391696
methyl 5-chloro-2-[(2S)-2-phenylpyrrolidin-1-yl]pyridine-3-carboxylate (PubChem CID 129391696) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is methyl 5-chloro-2-[(2S)-2-phenylpyrrolidin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 5-chloro-2-[(2S)-2-phenylpyrrolidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 129391696 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | methyl 5-chloro-2-[(2S)-2-phenylpyrrolidin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(Cl)cnc1N1CCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17ClN2O2/c1-22-17(21)14-10-13(18)11-19-16(14)20-9-5-8-15(20)12-6-3-2-4-7-12/h2-4,6-7,10-11,15H,5,8-9H2,1H3/t15-/m0/s1 |
| InChIKey | PRMUNGBSOQVRSW-HNNXBMFYSA-N |
| XLogP | 3.86 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |