C16H17BrN2 — CID 112697443
5-bromo-3-methyl-2-(2-phenylpyrrolidin-1-yl)pyridine (PubChem CID 112697443) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 5-bromo-3-methyl-2-(2-phenylpyrrolidin-1-yl)pyridine.
| Compound Name | 5-bromo-3-methyl-2-(2-phenylpyrrolidin-1-yl)pyridine |
|---|---|
| PubChem CID | 112697443 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 5-bromo-3-methyl-2-(2-phenylpyrrolidin-1-yl)pyridine |
| SMILES | Cc1cc(Br)cnc1N1CCCC1c1ccccc1 |
| InChI | InChI=1S/C16H17BrN2/c1-12-10-14(17)11-18-16(12)19-9-5-8-15(19)13-6-3-2-4-7-13/h2-4,6-7,10-11,15H,5,8-9H2,1H3 |
| InChIKey | DBQXWCDRVVQRRP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |