C16H19FN2O3 — CID 129393431
methyl 2-[(2S)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 129393431) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is methyl 2-[(2S)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[(2S)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 129393431 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | methyl 2-[(2S)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C(=O)NCCN1C/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FN2O3/c1-22-15(20)11-14-16(21)18-8-10-19(14)9-2-3-12-4-6-13(17)7-5-12/h2-7,14H,8-11H2,1H3,(H,18,21)/b3-2+/t14-/m0/s1 |
| InChIKey | PGPRRSXNJAGABJ-HSWBROFVSA-N |
| XLogP | 1.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |