C15H19FN2O4 — CID 47010477
methyl 2-[1-[2-(4-fluorophenoxy)ethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 47010477) has the molecular formula C15H19FN2O4 and a molecular weight of 310.32 g/mol. Its IUPAC name is methyl 2-[1-[2-(4-fluorophenoxy)ethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-[2-(4-fluorophenoxy)ethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 47010477 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | methyl 2-[1-[2-(4-fluorophenoxy)ethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O4/c1-21-14(19)10-13-15(20)17-6-7-18(13)8-9-22-12-4-2-11(16)3-5-12/h2-5,13H,6-10H2,1H3,(H,17,20) |
| InChIKey | OFEUKNZUFMMHHX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |