C14H21Cl2N2O2P — CID 129395055
N-[amino-[(1S)-1-phenylbut-3-enoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine (PubChem CID 129395055) has the molecular formula C14H21Cl2N2O2P and a molecular weight of 351.21 g/mol. Its IUPAC name is N-[amino-[(1S)-1-phenylbut-3-enoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine.
| Compound Name | N-[amino-[(1S)-1-phenylbut-3-enoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
|---|---|
| PubChem CID | 129395055 |
| Molecular Formula | C14H21Cl2N2O2P |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N-[amino-[(1S)-1-phenylbut-3-enoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
| SMILES | C=CC[C@H](O[P@](N)(=O)N(CCCl)CCCl)c1ccccc1 |
| InChI | InChI=1S/C14H21Cl2N2O2P/c1-2-6-14(13-7-4-3-5-8-13)20-21(17,19)18(11-9-15)12-10-16/h2-5,7-8,14H,1,6,9-12H2,(H2,17,19)/t14-,21-/m0/s1 |
| InChIKey | BCRZCLWCMUKTQR-QKKBWIMNSA-N |
| XLogP | 4.17 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|