C16H20Cl2NO3P — CID 21117531
1,1'-biphenyl;bis(2-chloroethyl)aminophosphonic acid (PubChem CID 21117531) has the molecular formula C16H20Cl2NO3P and a molecular weight of 376.22 g/mol. Its IUPAC name is 1,1'-biphenyl;bis(2-chloroethyl)aminophosphonic acid.
| Compound Name | 1,1'-biphenyl;bis(2-chloroethyl)aminophosphonic acid |
|---|---|
| PubChem CID | 21117531 |
| Molecular Formula | C16H20Cl2NO3P |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1,1'-biphenyl;bis(2-chloroethyl)aminophosphonic acid |
| SMILES | O=P(O)(O)N(CCCl)CCCl.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H10Cl2NO3P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;5-1-3-7(4-2-6)11(8,9)10/h1-10H;1-4H2,(H2,8,9,10) |
| InChIKey | WJOZUFADTUOSCU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|