C14H23Cl2N4OPS — CID 10475901
1-[bis(2-chloroethyl)amino-(propan-2-ylamino)phosphoryl]-3-phenylthiourea (PubChem CID 10475901) has the molecular formula C14H23Cl2N4OPS and a molecular weight of 397.31 g/mol. Its IUPAC name is 1-[bis(2-chloroethyl)amino-(propan-2-ylamino)phosphoryl]-3-phenylthiourea.
| Compound Name | 1-[bis(2-chloroethyl)amino-(propan-2-ylamino)phosphoryl]-3-phenylthiourea |
|---|---|
| PubChem CID | 10475901 |
| Molecular Formula | C14H23Cl2N4OPS |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 1-[bis(2-chloroethyl)amino-(propan-2-ylamino)phosphoryl]-3-phenylthiourea |
| SMILES | CC(C)NP(=O)(NC(=S)Nc1ccccc1)N(CCCl)CCCl |
| InChI | InChI=1S/C14H23Cl2N4OPS/c1-12(2)18-22(21,20(10-8-15)11-9-16)19-14(23)17-13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3,(H3,17,18,19,21,23) |
| InChIKey | LPYFISQJCSDXNB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|