C11H17Cl2N2O2P — CID 10041181
N-[azanyl(phenylmethoxy)(15N)phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine (PubChem CID 10041181) has the molecular formula C11H17Cl2N2O2P and a molecular weight of 312.14 g/mol. Its IUPAC name is N-[azanyl(phenylmethoxy)(15N)phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine.
| Compound Name | N-[azanyl(phenylmethoxy)(15N)phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
|---|---|
| PubChem CID | 10041181 |
| Molecular Formula | C11H17Cl2N2O2P |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-[azanyl(phenylmethoxy)(15N)phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
| SMILES | [15NH2]P(=O)(OCc1ccccc1)N(CCCl)CCCl |
| InChI | InChI=1S/C11H17Cl2N2O2P/c12-6-8-15(9-7-13)18(14,16)17-10-11-4-2-1-3-5-11/h1-5H,6-10H2,(H2,14,16)/i14+1 |
| InChIKey | JSZWFLWJWIMZLD-UJKGMGNHSA-N |
| XLogP | 3.05 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|