C16H26Cl2N5O4P — CID 59248864
(2S)-2-amino-N-[4-[[amino-[bis(2-chloroethyl)amino]phosphoryl]oxymethyl]phenyl]pentanediamide (PubChem CID 59248864) has the molecular formula C16H26Cl2N5O4P and a molecular weight of 454.30 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[[amino-[bis(2-chloroethyl)amino]phosphoryl]oxymethyl]phenyl]pentanediamide.
| Compound Name | (2S)-2-amino-N-[4-[[amino-[bis(2-chloroethyl)amino]phosphoryl]oxymethyl]phenyl]pentanediamide |
|---|---|
| PubChem CID | 59248864 |
| Molecular Formula | C16H26Cl2N5O4P |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (2S)-2-amino-N-[4-[[amino-[bis(2-chloroethyl)amino]phosphoryl]oxymethyl]phenyl]pentanediamide |
| SMILES | NC(=O)CC[C@H](N)C(=O)Nc1ccc(COP(N)(=O)N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C16H26Cl2N5O4P/c17-7-9-23(10-8-18)28(21,26)27-11-12-1-3-13(4-2-12)22-16(25)14(19)5-6-15(20)24/h1-4,14H,5-11,19H2,(H2,20,24)(H2,21,26)(H,22,25)/t14-,28?/m0/s1 |
| InChIKey | XGYPDODJWLMTCB-DCXKMBIZSA-N |
| XLogP | 1.58 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|