C18H29NO3 — CID 129398630
propan-2-yl 2-[(3S)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]acetate (PubChem CID 129398630) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is propan-2-yl 2-[(3S)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(3S)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 129398630 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | propan-2-yl 2-[(3S)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)C[C@@H]1CCCN(C(=O)CC2=CCCCC2)C1 |
| InChI | InChI=1S/C18H29NO3/c1-14(2)22-18(21)12-16-9-6-10-19(13-16)17(20)11-15-7-4-3-5-8-15/h7,14,16H,3-6,8-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | SUPHPEUXYZNTKV-INIZCTEOSA-N |
| XLogP | 3.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|