C23H31ClN2O3 — CID 25477368
N-(5-chloro-2-methoxyphenyl)-3-[(3R)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]propanamide (PubChem CID 25477368) has the molecular formula C23H31ClN2O3 and a molecular weight of 418.97 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-3-[(3R)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]propanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-3-[(3R)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 25477368 |
| Molecular Formula | C23H31ClN2O3 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-3-[(3R)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]propanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CC[C@H]1CCCN(C(=O)CC2=CCCCC2)C1 |
| InChI | InChI=1S/C23H31ClN2O3/c1-29-21-11-10-19(24)15-20(21)25-22(27)12-9-18-8-5-13-26(16-18)23(28)14-17-6-3-2-4-7-17/h6,10-11,15,18H,2-5,7-9,12-14,16H2,1H3,(H,25,27)/t18-/m1/s1 |
| InChIKey | JHNJRGLXZNVMAZ-GOSISDBHSA-N |
| XLogP | 5.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|