C18H27ClN2O4S — CID 97280553
N-(5-chloro-2-methoxyphenyl)-3-[(3S)-1-propylsulfonylpiperidin-3-yl]propanamide (PubChem CID 97280553) has the molecular formula C18H27ClN2O4S and a molecular weight of 402.94 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-3-[(3S)-1-propylsulfonylpiperidin-3-yl]propanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-3-[(3S)-1-propylsulfonylpiperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 97280553 |
| Molecular Formula | C18H27ClN2O4S |
| Molecular Weight | 402.94 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-3-[(3S)-1-propylsulfonylpiperidin-3-yl]propanamide |
| SMILES | CCCS(=O)(=O)N1CCC[C@@H](CCC(=O)Nc2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C18H27ClN2O4S/c1-3-11-26(23,24)21-10-4-5-14(13-21)6-9-18(22)20-16-12-15(19)7-8-17(16)25-2/h7-8,12,14H,3-6,9-11,13H2,1-2H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | MVIZBMSRBVLRQX-AWEZNQCLSA-N |
| XLogP | 3.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.94 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |