C23H27ClN2O3 — CID 42193450
N-(5-chloro-2-methoxyphenyl)-3-[(3S)-1-(2-methylbenzoyl)piperidin-3-yl]propanamide (PubChem CID 42193450) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-3-[(3S)-1-(2-methylbenzoyl)piperidin-3-yl]propanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-3-[(3S)-1-(2-methylbenzoyl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 42193450 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-3-[(3S)-1-(2-methylbenzoyl)piperidin-3-yl]propanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CC[C@@H]1CCCN(C(=O)c2ccccc2C)C1 |
| InChI | InChI=1S/C23H27ClN2O3/c1-16-6-3-4-8-19(16)23(28)26-13-5-7-17(15-26)9-12-22(27)25-20-14-18(24)10-11-21(20)29-2/h3-4,6,8,10-11,14,17H,5,7,9,12-13,15H2,1-2H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | AKAAUBGFJQNVHF-KRWDZBQOSA-N |
| XLogP | 4.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |