C19H28ClN3O4 — CID 97278510
(3S)-3-[3-(5-chloro-2-methoxyanilino)-3-oxopropyl]-N-(2-methoxyethyl)piperidine-1-carboxamide (PubChem CID 97278510) has the molecular formula C19H28ClN3O4 and a molecular weight of 397.90 g/mol. Its IUPAC name is (3S)-3-[3-(5-chloro-2-methoxyanilino)-3-oxopropyl]-N-(2-methoxyethyl)piperidine-1-carboxamide.
| Compound Name | (3S)-3-[3-(5-chloro-2-methoxyanilino)-3-oxopropyl]-N-(2-methoxyethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97278510 |
| Molecular Formula | C19H28ClN3O4 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (3S)-3-[3-(5-chloro-2-methoxyanilino)-3-oxopropyl]-N-(2-methoxyethyl)piperidine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCC[C@@H](CCC(=O)Nc2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C19H28ClN3O4/c1-26-11-9-21-19(25)23-10-3-4-14(13-23)5-8-18(24)22-16-12-15(20)6-7-17(16)27-2/h6-7,12,14H,3-5,8-11,13H2,1-2H3,(H,21,25)(H,22,24)/t14-/m0/s1 |
| InChIKey | AACLMPWVUXHVBB-AWEZNQCLSA-N |
| XLogP | 3.14 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|