C19H19N3O3 — CID 129402676
3-(6-methoxy-3-pyridinyl)-5-[(2R,3R)-2-phenyloxan-3-yl]-1,2,4-oxadiazole (PubChem CID 129402676) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-(6-methoxy-3-pyridinyl)-5-[(2R,3R)-2-phenyloxan-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(6-methoxy-3-pyridinyl)-5-[(2R,3R)-2-phenyloxan-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 129402676 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-(6-methoxy-3-pyridinyl)-5-[(2R,3R)-2-phenyloxan-3-yl]-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc([C@@H]3CCCO[C@H]3c3ccccc3)n2)cn1 |
| InChI | InChI=1S/C19H19N3O3/c1-23-16-10-9-14(12-20-16)18-21-19(25-22-18)15-8-5-11-24-17(15)13-6-3-2-4-7-13/h2-4,6-7,9-10,12,15,17H,5,8,11H2,1H3/t15-,17+/m1/s1 |
| InChIKey | QWIQZTWCTIUGRE-WBVHZDCISA-N |
| XLogP | 3.78 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |