C19H22N4O4 — CID 127995920
[6-[3-(6-methoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-en-1-yl]-morpholin-4-ylmethanone (PubChem CID 127995920) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is [6-[3-(6-methoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-en-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-[3-(6-methoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-en-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 127995920 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [6-[3-(6-methoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-en-1-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(-c2noc(C3CC=CCC3C(=O)N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C19H22N4O4/c1-25-16-7-6-13(12-20-16)17-21-18(27-22-17)14-4-2-3-5-15(14)19(24)23-8-10-26-11-9-23/h2-3,6-7,12,14-15H,4-5,8-11H2,1H3 |
| InChIKey | ULIWYVFEQQEARC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|