C21H29N5O4 — CID 75131231
1-[4-[2-[3-[6-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]piperidin-1-yl]ethanone (PubChem CID 75131231) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-[4-[2-[3-[6-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[3-[6-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 75131231 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-[4-[2-[3-[6-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]piperidin-1-yl]ethanone |
| SMILES | COCCOc1ccc(-c2noc(C3CCCN3C3CCN(C(C)=O)CC3)n2)cn1 |
| InChI | InChI=1S/C21H29N5O4/c1-15(27)25-10-7-17(8-11-25)26-9-3-4-18(26)21-23-20(24-30-21)16-5-6-19(22-14-16)29-13-12-28-2/h5-6,14,17-18H,3-4,7-13H2,1-2H3 |
| InChIKey | LZZXHVITSHDVHB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|