C19H22N4O3S — CID 162799125
3-[6-(2-methoxyethoxy)-3-pyridinyl]-5-[(2R)-1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazole (PubChem CID 162799125) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 3-[6-(2-methoxyethoxy)-3-pyridinyl]-5-[(2R)-1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[6-(2-methoxyethoxy)-3-pyridinyl]-5-[(2R)-1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 162799125 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 3-[6-(2-methoxyethoxy)-3-pyridinyl]-5-[(2R)-1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazole |
| SMILES | COCCOc1ccc(-c2noc([C@H]3CCCN3Cc3cccs3)n2)cn1 |
| InChI | InChI=1S/C19H22N4O3S/c1-24-9-10-25-17-7-6-14(12-20-17)18-21-19(26-22-18)16-5-2-8-23(16)13-15-4-3-11-27-15/h3-4,6-7,11-12,16H,2,5,8-10,13H2,1H3/t16-/m1/s1 |
| InChIKey | XXKPSNYUYCEFJA-MRXNPFEDSA-N |
| XLogP | 3.56 |
| TPSA | 73.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|