C20H23N5O3 — CID 75131050
3-[2-(2-methoxyethoxy)-4-pyridinyl]-5-[1-(pyridin-4-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazole (PubChem CID 75131050) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)-4-pyridinyl]-5-[1-(pyridin-4-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[2-(2-methoxyethoxy)-4-pyridinyl]-5-[1-(pyridin-4-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 75131050 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)-4-pyridinyl]-5-[1-(pyridin-4-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazole |
| SMILES | COCCOc1cc(-c2noc(C3CCCN3Cc3ccncc3)n2)ccn1 |
| InChI | InChI=1S/C20H23N5O3/c1-26-11-12-27-18-13-16(6-9-22-18)19-23-20(28-24-19)17-3-2-10-25(17)14-15-4-7-21-8-5-15/h4-9,13,17H,2-3,10-12,14H2,1H3 |
| InChIKey | NIMXIIKBMDYCOB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 86.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|