C21H22F2N4O3 — CID 162799085
5-[(2R)-1-[(3,4-difluorophenyl)methyl]pyrrolidin-2-yl]-3-[4-(2-methoxyethoxy)-2-pyridinyl]-1,2,4-oxadiazole (PubChem CID 162799085) has the molecular formula C21H22F2N4O3 and a molecular weight of 416.43 g/mol. Its IUPAC name is 5-[(2R)-1-[(3,4-difluorophenyl)methyl]pyrrolidin-2-yl]-3-[4-(2-methoxyethoxy)-2-pyridinyl]-1,2,4-oxadiazole.
| Compound Name | 5-[(2R)-1-[(3,4-difluorophenyl)methyl]pyrrolidin-2-yl]-3-[4-(2-methoxyethoxy)-2-pyridinyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 162799085 |
| Molecular Formula | C21H22F2N4O3 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 5-[(2R)-1-[(3,4-difluorophenyl)methyl]pyrrolidin-2-yl]-3-[4-(2-methoxyethoxy)-2-pyridinyl]-1,2,4-oxadiazole |
| SMILES | COCCOc1ccnc(-c2noc([C@H]3CCCN3Cc3ccc(F)c(F)c3)n2)c1 |
| InChI | InChI=1S/C21H22F2N4O3/c1-28-9-10-29-15-6-7-24-18(12-15)20-25-21(30-26-20)19-3-2-8-27(19)13-14-4-5-16(22)17(23)11-14/h4-7,11-12,19H,2-3,8-10,13H2,1H3/t19-/m1/s1 |
| InChIKey | VBTPZZRGHNNTOC-LJQANCHMSA-N |
| XLogP | 3.77 |
| TPSA | 73.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|