C22H26N4O5S — CID 163060423
3-[4-(2-methoxyethoxy)-2-pyridinyl]-5-[(2R)-1-[(4-methylsulfonylphenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole (PubChem CID 163060423) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is 3-[4-(2-methoxyethoxy)-2-pyridinyl]-5-[(2R)-1-[(4-methylsulfonylphenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[4-(2-methoxyethoxy)-2-pyridinyl]-5-[(2R)-1-[(4-methylsulfonylphenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 163060423 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 3-[4-(2-methoxyethoxy)-2-pyridinyl]-5-[(2R)-1-[(4-methylsulfonylphenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole |
| SMILES | COCCOc1ccnc(-c2noc([C@H]3CCCN3Cc3ccc(S(C)(=O)=O)cc3)n2)c1 |
| InChI | InChI=1S/C22H26N4O5S/c1-29-12-13-30-17-9-10-23-19(14-17)21-24-22(31-25-21)20-4-3-11-26(20)15-16-5-7-18(8-6-16)32(2,27)28/h5-10,14,20H,3-4,11-13,15H2,1-2H3/t20-/m1/s1 |
| InChIKey | VQGBQVSZYRANKR-HXUWFJFHSA-N |
| XLogP | 2.90 |
| TPSA | 107.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|