C16H20N2O3S — CID 129403722
(2S)-4-[2-(2-methoxyphenoxy)ethyl]-2-(1,3-thiazol-2-yl)morpholine (PubChem CID 129403722) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is (2S)-4-[2-(2-methoxyphenoxy)ethyl]-2-(1,3-thiazol-2-yl)morpholine.
| Compound Name | (2S)-4-[2-(2-methoxyphenoxy)ethyl]-2-(1,3-thiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 129403722 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2S)-4-[2-(2-methoxyphenoxy)ethyl]-2-(1,3-thiazol-2-yl)morpholine |
| SMILES | COc1ccccc1OCCN1CCO[C@H](c2nccs2)C1 |
| InChI | InChI=1S/C16H20N2O3S/c1-19-13-4-2-3-5-14(13)20-9-7-18-8-10-21-15(12-18)16-17-6-11-22-16/h2-6,11,15H,7-10,12H2,1H3/t15-/m0/s1 |
| InChIKey | FIFZWSKSSYNTJG-HNNXBMFYSA-N |
| XLogP | 2.60 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |