C16H23N5O3 — CID 162629473
4-[2-(2-methoxy-4-methylphenoxy)ethyl]-2-(1-methyltetrazol-5-yl)morpholine (PubChem CID 162629473) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-[2-(2-methoxy-4-methylphenoxy)ethyl]-2-(1-methyltetrazol-5-yl)morpholine.
| Compound Name | 4-[2-(2-methoxy-4-methylphenoxy)ethyl]-2-(1-methyltetrazol-5-yl)morpholine |
|---|---|
| PubChem CID | 162629473 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 4-[2-(2-methoxy-4-methylphenoxy)ethyl]-2-(1-methyltetrazol-5-yl)morpholine |
| SMILES | COc1cc(C)ccc1OCCN1CCOC(c2nnnn2C)C1 |
| InChI | InChI=1S/C16H23N5O3/c1-12-4-5-13(14(10-12)22-3)23-8-6-21-7-9-24-15(11-21)16-17-18-19-20(16)2/h4-5,10,15H,6-9,11H2,1-3H3 |
| InChIKey | KARQMJIIJCEFNZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |